C18H18F4N2O4 — CID 88887215
4-[5-fluoro-2-oxo-4-[4-(trifluoromethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2,2-dimethylbutanamide (PubChem CID 88887215) has the molecular formula C18H18F4N2O4 and a molecular weight of 402.34 g/mol. Its IUPAC name is 4-[5-fluoro-2-oxo-4-[4-(trifluoromethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2,2-dimethylbutanamide.
| Compound Name | 4-[5-fluoro-2-oxo-4-[4-(trifluoromethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 88887215 |
| Molecular Formula | C18H18F4N2O4 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[5-fluoro-2-oxo-4-[4-(trifluoromethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2,2-dimethylbutanamide |
| SMILES | CC(C)(CCn1cc(F)c(-c2ccc(OC(F)(F)F)cc2)cc1=O)C(=O)NO |
| InChI | InChI=1S/C18H18F4N2O4/c1-17(2,16(26)23-27)7-8-24-10-14(19)13(9-15(24)25)11-3-5-12(6-4-11)28-18(20,21)22/h3-6,9-10,27H,7-8H2,1-2H3,(H,23,26) |
| InChIKey | KOBUYJKJXZLKMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|