C18H23FN2O5S — CID 151907638
5-fluoro-1-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonylbutyl]-4-(3-methoxyphenyl)pyridin-2-one (PubChem CID 151907638) has the molecular formula C18H23FN2O5S and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-fluoro-1-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonylbutyl]-4-(3-methoxyphenyl)pyridin-2-one.
| Compound Name | 5-fluoro-1-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonylbutyl]-4-(3-methoxyphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 151907638 |
| Molecular Formula | C18H23FN2O5S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5-fluoro-1-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonylbutyl]-4-(3-methoxyphenyl)pyridin-2-one |
| SMILES | COc1cccc(-c2cc(=O)n(CC[C@](C)(CNO)S(C)(=O)=O)cc2F)c1 |
| InChI | InChI=1S/C18H23FN2O5S/c1-18(12-20-23,27(3,24)25)7-8-21-11-16(19)15(10-17(21)22)13-5-4-6-14(9-13)26-2/h4-6,9-11,20,23H,7-8,12H2,1-3H3/t18-/m1/s1 |
| InChIKey | SUBSEVNCGMBXJF-GOSISDBHSA-N |
| XLogP | 1.84 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|