C22H29F3N2O4 — CID 159450635
N-hydroxy-2,2-dimethyl-3-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methylamino]propanamide;propane (PubChem CID 159450635) has the molecular formula C22H29F3N2O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-3-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methylamino]propanamide;propane.
| Compound Name | N-hydroxy-2,2-dimethyl-3-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methylamino]propanamide;propane |
|---|---|
| PubChem CID | 159450635 |
| Molecular Formula | C22H29F3N2O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-3-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methylamino]propanamide;propane |
| SMILES | CC(C)(CNCc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)C(=O)NO.CCC |
| InChI | InChI=1S/C19H21F3N2O4.C3H8/c1-18(2,17(25)24-26)12-23-11-13-3-5-14(6-4-13)27-15-7-9-16(10-8-15)28-19(20,21)22;1-3-2/h3-10,23,26H,11-12H2,1-2H3,(H,24,25);3H2,1-2H3 |
| InChIKey | LTICYJMZHHULRG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|