C13H16F3NO3 — CID 63787638
tert-butyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 63787638) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is tert-butyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 63787638 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | tert-butyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO3/c1-12(2,3)20-11(18)17-8-9-4-6-10(7-5-9)19-13(14,15)16/h4-7H,8H2,1-3H3,(H,17,18) |
| InChIKey | FVCXXXSNXQFQKR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |