C13H15F3INO3 — CID 129185814
tert-butyl N-[[2-iodo-5-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 129185814) has the molecular formula C13H15F3INO3 and a molecular weight of 417.17 g/mol. Its IUPAC name is tert-butyl N-[[2-iodo-5-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-iodo-5-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 129185814 |
| Molecular Formula | C13H15F3INO3 |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | tert-butyl N-[[2-iodo-5-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(OC(F)(F)F)ccc1I |
| InChI | InChI=1S/C13H15F3INO3/c1-12(2,3)21-11(19)18-7-8-6-9(4-5-10(8)17)20-13(14,15)16/h4-6H,7H2,1-3H3,(H,18,19) |
| InChIKey | GWDSWAWGXRMHGI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|