C15H22FNO4 — CID 20777475
tert-butyl N-[[5-(dimethoxymethyl)-2-fluorophenyl]methyl]carbamate (PubChem CID 20777475) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is tert-butyl N-[[5-(dimethoxymethyl)-2-fluorophenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(dimethoxymethyl)-2-fluorophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 20777475 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | tert-butyl N-[[5-(dimethoxymethyl)-2-fluorophenyl]methyl]carbamate |
| SMILES | COC(OC)c1ccc(F)c(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H22FNO4/c1-15(2,3)21-14(18)17-9-11-8-10(6-7-12(11)16)13(19-4)20-5/h6-8,13H,9H2,1-5H3,(H,17,18) |
| InChIKey | ZKZVMUCESZJWAB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|