C21H19F6NO4 — CID 59458426
tert-butyl N-[[2-fluoro-5-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzoyl]phenyl]methyl]carbamate (PubChem CID 59458426) has the molecular formula C21H19F6NO4 and a molecular weight of 463.37 g/mol. Its IUPAC name is tert-butyl N-[[2-fluoro-5-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-fluoro-5-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59458426 |
| Molecular Formula | C21H19F6NO4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | tert-butyl N-[[2-fluoro-5-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(C(=O)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C21H19F6NO4/c1-20(2,3)32-19(30)28-10-13-6-11(4-5-16(13)23)17(29)12-7-14(22)9-15(8-12)31-21(26,27)18(24)25/h4-9,18H,10H2,1-3H3,(H,28,30) |
| InChIKey | RADVRSRYIMKSMD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|