C16H20F3NO4 — CID 170491286
tert-butyl N-[4-[2-hydroxy-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate (PubChem CID 170491286) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is tert-butyl N-[4-[2-hydroxy-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-hydroxy-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491286 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | tert-butyl N-[4-[2-hydroxy-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc(OC(F)(F)F)cc1O |
| InChI | InChI=1S/C16H20F3NO4/c1-15(2,3)24-14(22)20-9-5-4-6-11-7-8-12(10-13(11)21)23-16(17,18)19/h4,6-8,10,21H,5,9H2,1-3H3,(H,20,22) |
| InChIKey | WJJVAXWXPNSCPZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|