C14H18F2N2O2 — CID 170490190
tert-butyl N-[4-(2,6-difluoro-3-pyridinyl)but-3-enyl]carbamate (PubChem CID 170490190) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is tert-butyl N-[4-(2,6-difluoro-3-pyridinyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,6-difluoro-3-pyridinyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490190 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | tert-butyl N-[4-(2,6-difluoro-3-pyridinyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc(F)nc1F |
| InChI | InChI=1S/C14H18F2N2O2/c1-14(2,3)20-13(19)17-9-5-4-6-10-7-8-11(15)18-12(10)16/h4,6-8H,5,9H2,1-3H3,(H,17,19) |
| InChIKey | JFBLVTIKMZBITA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|