C11H12F3NO4 — CID 79346573
2-hydroxyethyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 79346573) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-hydroxyethyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 79346573 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-hydroxyethyl N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)OCCO |
| InChI | InChI=1S/C11H12F3NO4/c12-11(13,14)19-9-3-1-8(2-4-9)7-15-10(17)18-6-5-16/h1-4,16H,5-7H2,(H,15,17) |
| InChIKey | OYUIESPWIUANNA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |