C25H29F3N2O4 — CID 123278626
tert-butyl N-[[4-[4-[4-(trifluoromethoxy)benzoyl]piperidin-1-yl]phenyl]methyl]carbamate (PubChem CID 123278626) has the molecular formula C25H29F3N2O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-[4-(trifluoromethoxy)benzoyl]piperidin-1-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-[4-(trifluoromethoxy)benzoyl]piperidin-1-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 123278626 |
| Molecular Formula | C25H29F3N2O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | tert-butyl N-[[4-[4-[4-(trifluoromethoxy)benzoyl]piperidin-1-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(N2CCC(C(=O)c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H29F3N2O4/c1-24(2,3)34-23(32)29-16-17-4-8-20(9-5-17)30-14-12-19(13-15-30)22(31)18-6-10-21(11-7-18)33-25(26,27)28/h4-11,19H,12-16H2,1-3H3,(H,29,32) |
| InChIKey | LSCUBNRLXNCEPP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|