C25H33N3O4 — CID 24516703
tert-butyl N-[[4-[methyl-[(4-morpholin-4-ylphenyl)methyl]carbamoyl]phenyl]methyl]carbamate (PubChem CID 24516703) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl N-[[4-[methyl-[(4-morpholin-4-ylphenyl)methyl]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[methyl-[(4-morpholin-4-ylphenyl)methyl]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 24516703 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl N-[[4-[methyl-[(4-morpholin-4-ylphenyl)methyl]carbamoyl]phenyl]methyl]carbamate |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-25(2,3)32-24(30)26-17-19-5-9-21(10-6-19)23(29)27(4)18-20-7-11-22(12-8-20)28-13-15-31-16-14-28/h5-12H,13-18H2,1-4H3,(H,26,30) |
| InChIKey | WDOXYDHSUVZFHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|