C23H37N3O4 — CID 175619946
tert-butyl N-[[1-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]piperidin-4-yl]methyl]carbamate (PubChem CID 175619946) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl N-[[1-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175619946 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl N-[[1-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(N2CCC(CNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H37N3O4/c1-22(2,3)29-20(27)24-15-17-7-9-19(10-8-17)26-13-11-18(12-14-26)16-25-21(28)30-23(4,5)6/h7-10,18H,11-16H2,1-6H3,(H,24,27)(H,25,28) |
| InChIKey | XGNKKMTZNNUVRK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|