C23H38N4O2 — CID 171652249
tert-butyl N-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperidin-4-yl]methyl]carbamate (PubChem CID 171652249) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is tert-butyl N-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171652249 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | tert-butyl N-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(CC2CCN(c3ccc(N)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H38N4O2/c1-23(2,3)29-22(28)25-16-18-8-12-26(13-9-18)17-19-10-14-27(15-11-19)21-6-4-20(24)5-7-21/h4-7,18-19H,8-17,24H2,1-3H3,(H,25,28) |
| InChIKey | ABXQIUIQGLGEGD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|