C17H27N3O4S — CID 23553541
tert-butyl N-[[1-(4-aminophenyl)sulfonylpiperidin-4-yl]methyl]carbamate (PubChem CID 23553541) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-aminophenyl)sulfonylpiperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-aminophenyl)sulfonylpiperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 23553541 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl N-[[1-(4-aminophenyl)sulfonylpiperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(S(=O)(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C17H27N3O4S/c1-17(2,3)24-16(21)19-12-13-8-10-20(11-9-13)25(22,23)15-6-4-14(18)5-7-15/h4-7,13H,8-12,18H2,1-3H3,(H,19,21) |
| InChIKey | HGIPAKNMCAECND-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|