C16H24N2O5S — CID 167214287
tert-butyl N-[1-(4-hydroxyphenyl)sulfonylpiperidin-4-yl]carbamate (PubChem CID 167214287) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is tert-butyl N-[1-(4-hydroxyphenyl)sulfonylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-hydroxyphenyl)sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 167214287 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | tert-butyl N-[1-(4-hydroxyphenyl)sulfonylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C16H24N2O5S/c1-16(2,3)23-15(20)17-12-8-10-18(11-9-12)24(21,22)14-6-4-13(19)5-7-14/h4-7,12,19H,8-11H2,1-3H3,(H,17,20) |
| InChIKey | KIBIFQIWMODOAO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |