C20H31N3O7S2 — CID 45106440
tert-butyl N-[1-(3-morpholin-4-ylsulfonylphenyl)sulfonylpiperidin-4-yl]carbamate (PubChem CID 45106440) has the molecular formula C20H31N3O7S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is tert-butyl N-[1-(3-morpholin-4-ylsulfonylphenyl)sulfonylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-morpholin-4-ylsulfonylphenyl)sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 45106440 |
| Molecular Formula | C20H31N3O7S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | tert-butyl N-[1-(3-morpholin-4-ylsulfonylphenyl)sulfonylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H31N3O7S2/c1-20(2,3)30-19(24)21-16-7-9-22(10-8-16)31(25,26)17-5-4-6-18(15-17)32(27,28)23-11-13-29-14-12-23/h4-6,15-16H,7-14H2,1-3H3,(H,21,24) |
| InChIKey | VNEPFGXNWFASSY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |