C17H23BrF2N2O4S — CID 177048691
tert-butyl N-[1-[3-bromo-4-(difluoromethyl)phenyl]sulfonylpiperidin-4-yl]carbamate (PubChem CID 177048691) has the molecular formula C17H23BrF2N2O4S and a molecular weight of 469.35 g/mol. Its IUPAC name is tert-butyl N-[1-[3-bromo-4-(difluoromethyl)phenyl]sulfonylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-bromo-4-(difluoromethyl)phenyl]sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 177048691 |
| Molecular Formula | C17H23BrF2N2O4S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | tert-butyl N-[1-[3-bromo-4-(difluoromethyl)phenyl]sulfonylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2ccc(C(F)F)c(Br)c2)CC1 |
| InChI | InChI=1S/C17H23BrF2N2O4S/c1-17(2,3)26-16(23)21-11-6-8-22(9-7-11)27(24,25)12-4-5-13(15(19)20)14(18)10-12/h4-5,10-11,15H,6-9H2,1-3H3,(H,21,23) |
| InChIKey | FUZJGDVKFPYDIX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |