C16H24N2O4S — CID 46318295
tert-butyl N-[1-(benzenesulfonyl)piperidin-4-yl]carbamate (PubChem CID 46318295) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is tert-butyl N-[1-(benzenesulfonyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(benzenesulfonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 46318295 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl N-[1-(benzenesulfonyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2O4S/c1-16(2,3)22-15(19)17-13-9-11-18(12-10-13)23(20,21)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3,(H,17,19) |
| InChIKey | LVWZSWFLKZDSPJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |