C15H19BrF2N2O4S — CID 166174761
tert-butyl N-[(3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 166174761) has the molecular formula C15H19BrF2N2O4S and a molecular weight of 441.29 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 166174761 |
| Molecular Formula | C15H19BrF2N2O4S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | tert-butyl N-[(3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(S(=O)(=O)c2cc(Br)c(F)cc2F)C1 |
| InChI | InChI=1S/C15H19BrF2N2O4S/c1-15(2,3)24-14(21)19-9-4-5-20(8-9)25(22,23)13-6-10(16)11(17)7-12(13)18/h6-7,9H,4-5,8H2,1-3H3,(H,19,21)/t9-/m0/s1 |
| InChIKey | GNKUHDGUBJYWQX-VIFPVBQESA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|