C14H21BrN2O4S2 — CID 71632034
tert-butyl N-[1-(5-bromothiophen-2-yl)sulfonylpiperidin-3-yl]carbamate (PubChem CID 71632034) has the molecular formula C14H21BrN2O4S2 and a molecular weight of 425.37 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromothiophen-2-yl)sulfonylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-bromothiophen-2-yl)sulfonylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 71632034 |
| Molecular Formula | C14H21BrN2O4S2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | tert-butyl N-[1-(5-bromothiophen-2-yl)sulfonylpiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C14H21BrN2O4S2/c1-14(2,3)21-13(18)16-10-5-4-8-17(9-10)23(19,20)12-7-6-11(15)22-12/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,18) |
| InChIKey | VVTBJLAPLVPJDL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |