C17H23N3O4S — CID 170855227
tert-butyl N-[(3R)-1-(3-cyanophenyl)sulfonylpiperidin-3-yl]carbamate (PubChem CID 170855227) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(3-cyanophenyl)sulfonylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(3-cyanophenyl)sulfonylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 170855227 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | tert-butyl N-[(3R)-1-(3-cyanophenyl)sulfonylpiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(S(=O)(=O)c2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C17H23N3O4S/c1-17(2,3)24-16(21)19-14-7-5-9-20(12-14)25(22,23)15-8-4-6-13(10-15)11-18/h4,6,8,10,14H,5,7,9,12H2,1-3H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | BKINGOITSQMQEQ-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |