C19H24FN3O4S — CID 67242641
tert-butyl N-[1-(4-fluoroisoquinolin-5-yl)sulfonylpiperidin-3-yl]carbamate (PubChem CID 67242641) has the molecular formula C19H24FN3O4S and a molecular weight of 409.48 g/mol. Its IUPAC name is tert-butyl N-[1-(4-fluoroisoquinolin-5-yl)sulfonylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-fluoroisoquinolin-5-yl)sulfonylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67242641 |
| Molecular Formula | C19H24FN3O4S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | tert-butyl N-[1-(4-fluoroisoquinolin-5-yl)sulfonylpiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(S(=O)(=O)c2cccc3cncc(F)c23)C1 |
| InChI | InChI=1S/C19H24FN3O4S/c1-19(2,3)27-18(24)22-14-7-5-9-23(12-14)28(25,26)16-8-4-6-13-10-21-11-15(20)17(13)16/h4,6,8,10-11,14H,5,7,9,12H2,1-3H3,(H,22,24) |
| InChIKey | KUIPMIOMXLUALY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |