C21H26FN3O4S — CID 118488194
tert-butyl (4aR,7aR)-6-(4-fluoroisoquinolin-5-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate (PubChem CID 118488194) has the molecular formula C21H26FN3O4S and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl (4aR,7aR)-6-(4-fluoroisoquinolin-5-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl (4aR,7aR)-6-(4-fluoroisoquinolin-5-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118488194 |
| Molecular Formula | C21H26FN3O4S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | tert-butyl (4aR,7aR)-6-(4-fluoroisoquinolin-5-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2CN(S(=O)(=O)c3cccc4cncc(F)c34)C[C@@H]21 |
| InChI | InChI=1S/C21H26FN3O4S/c1-21(2,3)29-20(26)25-9-5-7-15-12-24(13-17(15)25)30(27,28)18-8-4-6-14-10-23-11-16(22)19(14)18/h4,6,8,10-11,15,17H,5,7,9,12-13H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | VVZNEEQPSMOECI-WBVHZDCISA-N |
| XLogP | 3.39 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |