C20H24BrN3O4S — CID 126556208
tert-butyl (3aS,6aS)-5-(4-bromoisoquinolin-5-yl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate (PubChem CID 126556208) has the molecular formula C20H24BrN3O4S and a molecular weight of 482.40 g/mol. Its IUPAC name is tert-butyl (3aS,6aS)-5-(4-bromoisoquinolin-5-yl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aS,6aS)-5-(4-bromoisoquinolin-5-yl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 126556208 |
| Molecular Formula | C20H24BrN3O4S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | tert-butyl (3aS,6aS)-5-(4-bromoisoquinolin-5-yl)sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2CN(S(=O)(=O)c3cccc4cncc(Br)c34)C[C@H]21 |
| InChI | InChI=1S/C20H24BrN3O4S/c1-20(2,3)28-19(25)24-8-7-14-11-23(12-16(14)24)29(26,27)17-6-4-5-13-9-22-10-15(21)18(13)17/h4-6,9-10,14,16H,7-8,11-12H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | FEMVEACPWXRCAX-GOEBONIOSA-N |
| XLogP | 3.63 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |