C19H25N3O4S — CID 59684337
tert-butyl (4S)-4-methyl-3-(4-methylisoquinolin-5-yl)sulfonylimidazolidine-1-carboxylate (PubChem CID 59684337) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is tert-butyl (4S)-4-methyl-3-(4-methylisoquinolin-5-yl)sulfonylimidazolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-methyl-3-(4-methylisoquinolin-5-yl)sulfonylimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 59684337 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | tert-butyl (4S)-4-methyl-3-(4-methylisoquinolin-5-yl)sulfonylimidazolidine-1-carboxylate |
| SMILES | Cc1cncc2cccc(S(=O)(=O)N3CN(C(=O)OC(C)(C)C)C[C@@H]3C)c12 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-9-20-10-15-7-6-8-16(17(13)15)27(24,25)22-12-21(11-14(22)2)18(23)26-19(3,4)5/h6-10,14H,11-12H2,1-5H3/t14-/m0/s1 |
| InChIKey | HDHHMLOKTZLVBY-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |