C19H25N3O4S — CID 67245848
tert-butyl N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 67245848) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67245848 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | tert-butyl N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | Cc1cncc2cccc(S(=O)(=O)N3CC[C@@H](NC(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-10-20-11-14-6-5-7-16(17(13)14)27(24,25)22-9-8-15(12-22)21-18(23)26-19(2,3)4/h5-7,10-11,15H,8-9,12H2,1-4H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | ZBIQPJFPSIZPLZ-OAHLLOKOSA-N |
| XLogP | 2.83 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |