C14H19Cl2N3O4S — CID 123962338
tert-butyl N-[1-[(2,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-yl]carbamate (PubChem CID 123962338) has the molecular formula C14H19Cl2N3O4S and a molecular weight of 396.30 g/mol. Its IUPAC name is tert-butyl N-[1-[(2,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123962338 |
| Molecular Formula | C14H19Cl2N3O4S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | tert-butyl N-[1-[(2,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2ccc(Cl)nc2Cl)C1 |
| InChI | InChI=1S/C14H19Cl2N3O4S/c1-14(2,3)23-13(20)17-9-6-7-19(8-9)24(21,22)10-4-5-11(15)18-12(10)16/h4-5,9H,6-8H2,1-3H3,(H,17,20) |
| InChIKey | JCKVWHRFINENAH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|