C16H20ClF3N2O4S — CID 102557831
tert-butyl N-[1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 102557831) has the molecular formula C16H20ClF3N2O4S and a molecular weight of 428.86 g/mol. Its IUPAC name is tert-butyl N-[1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 102557831 |
| Molecular Formula | C16H20ClF3N2O4S |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | tert-butyl N-[1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2c(Cl)cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20ClF3N2O4S/c1-15(2,3)26-14(23)21-10-7-8-22(9-10)27(24,25)13-11(16(18,19)20)5-4-6-12(13)17/h4-6,10H,7-9H2,1-3H3,(H,21,23) |
| InChIKey | OEMLEGYPTDRGSL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |