C17H24ClFN2O4S — CID 71632038
tert-butyl N-[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-3-yl]carbamate (PubChem CID 71632038) has the molecular formula C17H24ClFN2O4S and a molecular weight of 406.91 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 71632038 |
| Molecular Formula | C17H24ClFN2O4S |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | tert-butyl N-[1-[(2-chloro-6-fluorophenyl)methylsulfonyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(S(=O)(=O)Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C17H24ClFN2O4S/c1-17(2,3)25-16(22)20-12-6-5-9-21(10-12)26(23,24)11-13-14(18)7-4-8-15(13)19/h4,7-8,12H,5-6,9-11H2,1-3H3,(H,20,22) |
| InChIKey | PGWHPHUONNFPFQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |