C18H21Cl2N3O4S — CID 86627809
tert-butyl N-[(3R)-1-(1,4-dichloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 86627809) has the molecular formula C18H21Cl2N3O4S and a molecular weight of 446.36 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(1,4-dichloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(1,4-dichloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86627809 |
| Molecular Formula | C18H21Cl2N3O4S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | tert-butyl N-[(3R)-1-(1,4-dichloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(S(=O)(=O)c2cccc3c(Cl)ncc(Cl)c23)C1 |
| InChI | InChI=1S/C18H21Cl2N3O4S/c1-18(2,3)27-17(24)22-11-7-8-23(10-11)28(25,26)14-6-4-5-12-15(14)13(19)9-21-16(12)20/h4-6,9,11H,7-8,10H2,1-3H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | VTMCQJGPDRKZFU-LLVKDONJSA-N |
| XLogP | 3.83 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|