C19H23BrClN3O4S — CID 87322379
tert-butyl N-[1-(4-bromo-1-chloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-N-methylcarbamate (PubChem CID 87322379) has the molecular formula C19H23BrClN3O4S and a molecular weight of 504.83 g/mol. Its IUPAC name is tert-butyl N-[1-(4-bromo-1-chloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(4-bromo-1-chloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 87322379 |
| Molecular Formula | C19H23BrClN3O4S |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | tert-butyl N-[1-(4-bromo-1-chloroisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(S(=O)(=O)c2cccc3c(Cl)ncc(Br)c23)C1 |
| InChI | InChI=1S/C19H23BrClN3O4S/c1-19(2,3)28-18(25)23(4)12-8-9-24(11-12)29(26,27)15-7-5-6-13-16(15)14(20)10-22-17(13)21/h5-7,10,12H,8-9,11H2,1-4H3 |
| InChIKey | SNMQLULXFDBYJD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|