C15H22BrClN4O2 — CID 123842349
tert-butyl N-[1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate (PubChem CID 123842349) has the molecular formula C15H22BrClN4O2 and a molecular weight of 405.72 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123842349 |
| Molecular Formula | C15H22BrClN4O2 |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | tert-butyl N-[1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(c2nc(Cl)ncc2Br)CC1 |
| InChI | InChI=1S/C15H22BrClN4O2/c1-15(2,3)23-14(22)20(4)10-5-7-21(8-6-10)12-11(16)9-18-13(17)19-12/h9-10H,5-8H2,1-4H3 |
| InChIKey | JISJNGOZEXNLDK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |