C17H27ClN4O3 — CID 175640149
tert-butyl N-[1-(6-chloro-2-ethoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate (PubChem CID 175640149) has the molecular formula C17H27ClN4O3 and a molecular weight of 370.88 g/mol. Its IUPAC name is tert-butyl N-[1-(6-chloro-2-ethoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(6-chloro-2-ethoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175640149 |
| Molecular Formula | C17H27ClN4O3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | tert-butyl N-[1-(6-chloro-2-ethoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate |
| SMILES | CCOc1nc(Cl)cc(N2CCC(N(C)C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C17H27ClN4O3/c1-6-24-15-19-13(18)11-14(20-15)22-9-7-12(8-10-22)21(5)16(23)25-17(2,3)4/h11-12H,6-10H2,1-5H3 |
| InChIKey | CIQDROXQQZGRLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |