C16H26N4O4S — CID 66798728
tert-butyl N-methyl-N-[1-(2-methylsulfonylpyrimidin-4-yl)piperidin-4-yl]carbamate (PubChem CID 66798728) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-(2-methylsulfonylpyrimidin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-(2-methylsulfonylpyrimidin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 66798728 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl N-methyl-N-[1-(2-methylsulfonylpyrimidin-4-yl)piperidin-4-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(c2ccnc(S(C)(=O)=O)n2)CC1 |
| InChI | InChI=1S/C16H26N4O4S/c1-16(2,3)24-15(21)19(4)12-7-10-20(11-8-12)13-6-9-17-14(18-13)25(5,22)23/h6,9,12H,7-8,10-11H2,1-5H3 |
| InChIKey | MILOKYBCUJUWJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |