C19H25N3O5S — CID 155425073
tert-butyl N-[(3S)-1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 155425073) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 155425073 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | Cc1c[n+]([O-])cc2cccc(S(=O)(=O)N3CC[C@H](NC(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C19H25N3O5S/c1-13-10-21(24)11-14-6-5-7-16(17(13)14)28(25,26)22-9-8-15(12-22)20-18(23)27-19(2,3)4/h5-7,10-11,15H,8-9,12H2,1-4H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | CGRQIBUSKYCLAG-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|