C18H28N2O4S — CID 71634480
tert-butyl N-[1-[(4-methylphenyl)methylsulfonyl]piperidin-3-yl]carbamate (PubChem CID 71634480) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-methylphenyl)methylsulfonyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-methylphenyl)methylsulfonyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 71634480 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | tert-butyl N-[1-[(4-methylphenyl)methylsulfonyl]piperidin-3-yl]carbamate |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCCC(NC(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H28N2O4S/c1-14-7-9-15(10-8-14)13-25(22,23)20-11-5-6-16(12-20)19-17(21)24-18(2,3)4/h7-10,16H,5-6,11-13H2,1-4H3,(H,19,21) |
| InChIKey | BYEGCGSHFWSPIW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |