C10H19ClN2O4S — CID 175525054
tert-butyl N-(1-chlorosulfonylpiperidin-3-yl)carbamate (PubChem CID 175525054) has the molecular formula C10H19ClN2O4S and a molecular weight of 298.79 g/mol. Its IUPAC name is tert-butyl N-(1-chlorosulfonylpiperidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-chlorosulfonylpiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 175525054 |
| Molecular Formula | C10H19ClN2O4S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | tert-butyl N-(1-chlorosulfonylpiperidin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(S(=O)(=O)Cl)C1 |
| InChI | InChI=1S/C10H19ClN2O4S/c1-10(2,3)17-9(14)12-8-5-4-6-13(7-8)18(11,15)16/h8H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | USMURKLBQBFMLE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |