C13H16ClF3N2O2S — CID 119963733
[1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanamine (PubChem CID 119963733) has the molecular formula C13H16ClF3N2O2S and a molecular weight of 356.80 g/mol. Its IUPAC name is [1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanamine.
| Compound Name | [1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 119963733 |
| Molecular Formula | C13H16ClF3N2O2S |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | [1-[2-chloro-6-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)c2c(Cl)cccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H16ClF3N2O2S/c14-11-3-1-2-10(13(15,16)17)12(11)22(20,21)19-6-4-9(8-18)5-7-19/h1-3,9H,4-8,18H2 |
| InChIKey | KQVBLBCXXJUIKO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |