C10H13Cl3N2O2S — CID 119971606
1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119971606) has the molecular formula C10H13Cl3N2O2S and a molecular weight of 331.65 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119971606 |
| Molecular Formula | C10H13Cl3N2O2S |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C10H12Cl2N2O2S.ClH/c11-8-2-1-3-9(12)10(8)17(15,16)14-5-4-7(13)6-14;/h1-3,7H,4-6,13H2;1H |
| InChIKey | UGXJSUYIGLTCAS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |