C12H15Cl2NO4S2 — CID 90586568
1-(2,6-dichlorophenyl)sulfonyl-4-methylsulfonylpiperidine (PubChem CID 90586568) has the molecular formula C12H15Cl2NO4S2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-4-methylsulfonylpiperidine.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-4-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 90586568 |
| Molecular Formula | C12H15Cl2NO4S2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-4-methylsulfonylpiperidine |
| SMILES | CS(=O)(=O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C12H15Cl2NO4S2/c1-20(16,17)9-5-7-15(8-6-9)21(18,19)12-10(13)3-2-4-11(12)14/h2-4,9H,5-8H2,1H3 |
| InChIKey | YQLIFXAQTRAFBK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |