C21H35NO4S2 — CID 90586582
4-methylsulfonyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine (PubChem CID 90586582) has the molecular formula C21H35NO4S2 and a molecular weight of 429.65 g/mol. Its IUPAC name is 4-methylsulfonyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine.
| Compound Name | 4-methylsulfonyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90586582 |
| Molecular Formula | C21H35NO4S2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-methylsulfonyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CCC(S(C)(=O)=O)CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C21H35NO4S2/c1-14(2)17-12-19(15(3)4)21(20(13-17)16(5)6)28(25,26)22-10-8-18(9-11-22)27(7,23)24/h12-16,18H,8-11H2,1-7H3 |
| InChIKey | DDVWEQOVBAXCOI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |