C22H37NO2S — CID 7046169
(2S)-2-ethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine (PubChem CID 7046169) has the molecular formula C22H37NO2S and a molecular weight of 379.61 g/mol. Its IUPAC name is (2S)-2-ethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine.
| Compound Name | (2S)-2-ethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 7046169 |
| Molecular Formula | C22H37NO2S |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2S)-2-ethyl-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperidine |
| SMILES | CC[C@H]1CCCCN1S(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C22H37NO2S/c1-8-19-11-9-10-12-23(19)26(24,25)22-20(16(4)5)13-18(15(2)3)14-21(22)17(6)7/h13-17,19H,8-12H2,1-7H3/t19-/m0/s1 |
| InChIKey | SLLVYVDIXLFMIR-IBGZPJMESA-N |
| XLogP | 6.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |