C13H17BrClNO2S — CID 42999354
1-(4-bromo-2-chlorophenyl)sulfonyl-2-ethylpiperidine (PubChem CID 42999354) has the molecular formula C13H17BrClNO2S and a molecular weight of 366.71 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)sulfonyl-2-ethylpiperidine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-2-ethylpiperidine |
|---|---|
| PubChem CID | 42999354 |
| Molecular Formula | C13H17BrClNO2S |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-2-ethylpiperidine |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H17BrClNO2S/c1-2-11-5-3-4-8-16(11)19(17,18)13-7-6-10(14)9-12(13)15/h6-7,9,11H,2-5,8H2,1H3 |
| InChIKey | FZVFPXPGZDXYJY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |