C12H14Br2FNO2S — CID 116530001
1-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)piperidine (PubChem CID 116530001) has the molecular formula C12H14Br2FNO2S and a molecular weight of 415.12 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)piperidine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)piperidine |
|---|---|
| PubChem CID | 116530001 |
| Molecular Formula | C12H14Br2FNO2S |
| Molecular Weight | 415.12 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)piperidine |
| SMILES | O=S(=O)(c1ccc(Br)cc1F)N1CCCCC1CBr |
| InChI | InChI=1S/C12H14Br2FNO2S/c13-8-10-3-1-2-6-16(10)19(17,18)12-5-4-9(14)7-11(12)15/h4-5,7,10H,1-3,6,8H2 |
| InChIKey | VXFFQJJRCLFYQI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.12 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|