C13H16Br3NO2S — CID 81327929
2-(bromomethyl)-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine (PubChem CID 81327929) has the molecular formula C13H16Br3NO2S and a molecular weight of 490.06 g/mol. Its IUPAC name is 2-(bromomethyl)-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine.
| Compound Name | 2-(bromomethyl)-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 81327929 |
| Molecular Formula | C13H16Br3NO2S |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 486.85 |
| IUPAC Name | 2-(bromomethyl)-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N2CCCCC2CBr)cc1Br |
| InChI | InChI=1S/C13H16Br3NO2S/c1-9-6-12(16)13(7-11(9)15)20(18,19)17-5-3-2-4-10(17)8-14/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | KBMXTKKGKDRIHV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|