C15H22BrNO3S — CID 104692826
[3-bromo-4-(2-ethylazepan-1-yl)sulfonylphenyl]methanol (PubChem CID 104692826) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is [3-bromo-4-(2-ethylazepan-1-yl)sulfonylphenyl]methanol.
| Compound Name | [3-bromo-4-(2-ethylazepan-1-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 104692826 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | [3-bromo-4-(2-ethylazepan-1-yl)sulfonylphenyl]methanol |
| SMILES | CCC1CCCCCN1S(=O)(=O)c1ccc(CO)cc1Br |
| InChI | InChI=1S/C15H22BrNO3S/c1-2-13-6-4-3-5-9-17(13)21(19,20)15-8-7-12(11-18)10-14(15)16/h7-8,10,13,18H,2-6,9,11H2,1H3 |
| InChIKey | OBHQKOUHVDMZJH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |