C12H15Br2NO3S — CID 81326897
[1-(2,5-dibromo-4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 81326897) has the molecular formula C12H15Br2NO3S and a molecular weight of 413.13 g/mol. Its IUPAC name is [1-(2,5-dibromo-4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(2,5-dibromo-4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 81326897 |
| Molecular Formula | C12H15Br2NO3S |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | [1-(2,5-dibromo-4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N2CCCC2CO)cc1Br |
| InChI | InChI=1S/C12H15Br2NO3S/c1-8-5-11(14)12(6-10(8)13)19(17,18)15-4-2-3-9(15)7-16/h5-6,9,16H,2-4,7H2,1H3 |
| InChIKey | MZWSKDAEHBIGGU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |