C11H14BrFN2O3S — CID 107212249
[(2R)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 107212249) has the molecular formula C11H14BrFN2O3S and a molecular weight of 353.21 g/mol. Its IUPAC name is [(2R)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 107212249 |
| Molecular Formula | C11H14BrFN2O3S |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | [(2R)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Nc1cc(Br)c(F)c(S(=O)(=O)N2CCC[C@@H]2CO)c1 |
| InChI | InChI=1S/C11H14BrFN2O3S/c12-9-4-7(14)5-10(11(9)13)19(17,18)15-3-1-2-8(15)6-16/h4-5,8,16H,1-3,6,14H2/t8-/m1/s1 |
| InChIKey | VPCCEPSXGRHJTQ-MRVPVSSYSA-N |
| XLogP | 1.32 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|