C10H12BrFN2O4S — CID 107213202
(3R,4S)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 107213202) has the molecular formula C10H12BrFN2O4S and a molecular weight of 355.19 g/mol. Its IUPAC name is (3R,4S)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 107213202 |
| Molecular Formula | C10H12BrFN2O4S |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | (3R,4S)-1-(5-amino-3-bromo-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | Nc1cc(Br)c(F)c(S(=O)(=O)N2C[C@@H](O)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C10H12BrFN2O4S/c11-6-1-5(13)2-9(10(6)12)19(17,18)14-3-7(15)8(16)4-14/h1-2,7-8,15-16H,3-4,13H2/t7-,8+ |
| InChIKey | CZQYXNQKFCQIAZ-OCAPTIKFSA-N |
| XLogP | -0.10 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|